C24H25FN2O4 — CID 147232856
methyl 4-[2-(4-fluorobenzoyl)imino-6-(hydroxymethyl)-3H-indol-1-yl]cyclohexane-1-carboxylate (PubChem CID 147232856) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is methyl 4-[2-(4-fluorobenzoyl)imino-6-(hydroxymethyl)-3H-indol-1-yl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[2-(4-fluorobenzoyl)imino-6-(hydroxymethyl)-3H-indol-1-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 147232856 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | methyl 4-[2-(4-fluorobenzoyl)imino-6-(hydroxymethyl)-3H-indol-1-yl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(N2/C(=N/C(=O)c3ccc(F)cc3)Cc3ccc(CO)cc32)CC1 |
| InChI | InChI=1S/C24H25FN2O4/c1-31-24(30)17-6-10-20(11-7-17)27-21-12-15(14-28)2-3-18(21)13-22(27)26-23(29)16-4-8-19(25)9-5-16/h2-5,8-9,12,17,20,28H,6-7,10-11,13-14H2,1H3/b26-22+ |
| InChIKey | CJGFUSBXVOHOOV-XTCLZLMSSA-N |
| XLogP | 3.65 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|