C32H41FN4O2 — CID 159095968
4-fluoro-N-[1-[4-(2-methylpropylcarbamoyl)cyclohexyl]-6-(piperidin-1-ylmethyl)-3H-indol-2-ylidene]benzamide (PubChem CID 159095968) has the molecular formula C32H41FN4O2 and a molecular weight of 532.70 g/mol. Its IUPAC name is 4-fluoro-N-[1-[4-(2-methylpropylcarbamoyl)cyclohexyl]-6-(piperidin-1-ylmethyl)-3H-indol-2-ylidene]benzamide.
| Compound Name | 4-fluoro-N-[1-[4-(2-methylpropylcarbamoyl)cyclohexyl]-6-(piperidin-1-ylmethyl)-3H-indol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 159095968 |
| Molecular Formula | C32H41FN4O2 |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 4-fluoro-N-[1-[4-(2-methylpropylcarbamoyl)cyclohexyl]-6-(piperidin-1-ylmethyl)-3H-indol-2-ylidene]benzamide |
| SMILES | CC(C)CNC(=O)C1CCC(N2/C(=N/C(=O)c3ccc(F)cc3)Cc3ccc(CN4CCCCC4)cc32)CC1 |
| InChI | InChI=1S/C32H41FN4O2/c1-22(2)20-34-31(38)24-10-14-28(15-11-24)37-29-18-23(21-36-16-4-3-5-17-36)6-7-26(29)19-30(37)35-32(39)25-8-12-27(33)13-9-25/h6-9,12-13,18,22,24,28H,3-5,10-11,14-17,19-21H2,1-2H3,(H,34,38)/b35-30+ |
| InChIKey | KCRBWWWYBIOYFD-WUZYOQQESA-N |
| XLogP | 5.74 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|