C24H30N2O3 — CID 15977516
(1S,4S,7R,9R)-3-[(E)-but-2-enoyl]-1,7,9-trimethyl-5-[(1S)-1-phenylethyl]-3,5-diazatricyclo[5.3.1.04,9]undecane-2,6-dione (PubChem CID 15977516) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is (1S,4S,7R,9R)-3-[(E)-but-2-enoyl]-1,7,9-trimethyl-5-[(1S)-1-phenylethyl]-3,5-diazatricyclo[5.3.1.04,9]undecane-2,6-dione.
| Compound Name | (1S,4S,7R,9R)-3-[(E)-but-2-enoyl]-1,7,9-trimethyl-5-[(1S)-1-phenylethyl]-3,5-diazatricyclo[5.3.1.04,9]undecane-2,6-dione |
|---|---|
| PubChem CID | 15977516 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (1S,4S,7R,9R)-3-[(E)-but-2-enoyl]-1,7,9-trimethyl-5-[(1S)-1-phenylethyl]-3,5-diazatricyclo[5.3.1.04,9]undecane-2,6-dione |
| SMILES | C/C=C/C(=O)N1C(=O)C2(C)CC3(C)C[C@](C)(C2)[C@H]1N([C@@H](C)c1ccccc1)C3=O |
| InChI | InChI=1S/C24H30N2O3/c1-6-10-18(27)26-19-22(3)13-23(4,15-24(5,14-22)21(26)29)20(28)25(19)16(2)17-11-8-7-9-12-17/h6-12,16,19H,13-15H2,1-5H3/b10-6+/t16-,19-,22+,23?,24?/m0/s1 |
| InChIKey | AFDVHSGKQIJFLU-MVUDUCDHSA-N |
| XLogP | 4.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|