C25H35ClF3N7O4 — CID 159778233
(2R,5S)-4-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-N-tert-butyl-5-[(4-chlorophenyl)methyl]morpholine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 159778233) has the molecular formula C25H35ClF3N7O4 and a molecular weight of 590.05 g/mol. Its IUPAC name is (2R,5S)-4-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-N-tert-butyl-5-[(4-chlorophenyl)methyl]morpholine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,5S)-4-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-N-tert-butyl-5-[(4-chlorophenyl)methyl]morpholine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159778233 |
| Molecular Formula | C25H35ClF3N7O4 |
| Molecular Weight | 590.05 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | (2R,5S)-4-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-N-tert-butyl-5-[(4-chlorophenyl)methyl]morpholine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)NC(=O)[C@H]1CN(C2CCN(c3n[nH]c(N)n3)CC2)[C@@H](Cc2ccc(Cl)cc2)CO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H34ClN7O2.C2HF3O2/c1-23(2,3)27-20(32)19-13-31(18(14-33-19)12-15-4-6-16(24)7-5-15)17-8-10-30(11-9-17)22-26-21(25)28-29-22;3-2(4,5)1(6)7/h4-7,17-19H,8-14H2,1-3H3,(H,27,32)(H3,25,26,28,29);(H,6,7)/t18-,19+;/m0./s1 |
| InChIKey | NIPCKAKLSOPMNY-GRTNUQQKSA-N |
| XLogP | 2.87 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.05 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |