C20H34O5Si — CID 159783595
3-oxocyclohexane-1-carboxylic acid;3-[1-(2-trimethylsilylethoxy)ethenyl]cyclohexan-1-one (PubChem CID 159783595) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is 3-oxocyclohexane-1-carboxylic acid;3-[1-(2-trimethylsilylethoxy)ethenyl]cyclohexan-1-one.
| Compound Name | 3-oxocyclohexane-1-carboxylic acid;3-[1-(2-trimethylsilylethoxy)ethenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 159783595 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 3-oxocyclohexane-1-carboxylic acid;3-[1-(2-trimethylsilylethoxy)ethenyl]cyclohexan-1-one |
| SMILES | C=C(OCC[Si](C)(C)C)C1CCCC(=O)C1.O=C1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C13H24O2Si.C7H10O3/c1-11(15-8-9-16(2,3)4)12-6-5-7-13(14)10-12;8-6-3-1-2-5(4-6)7(9)10/h12H,1,5-10H2,2-4H3;5H,1-4H2,(H,9,10) |
| InChIKey | NHRBTUOSPDVVJB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|