C21H40O4Si — CID 161025451
2-methylcyclohexane-1-carboxylic acid;2-trimethylsilylethyl 2-methylcyclohexane-1-carboxylate (PubChem CID 161025451) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is 2-methylcyclohexane-1-carboxylic acid;2-trimethylsilylethyl 2-methylcyclohexane-1-carboxylate.
| Compound Name | 2-methylcyclohexane-1-carboxylic acid;2-trimethylsilylethyl 2-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 161025451 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 2-methylcyclohexane-1-carboxylic acid;2-trimethylsilylethyl 2-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCCCC1C(=O)O.CC1CCCCC1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C13H26O2Si.C8H14O2/c1-11-7-5-6-8-12(11)13(14)15-9-10-16(2,3)4;1-6-4-2-3-5-7(6)8(9)10/h11-12H,5-10H2,1-4H3;6-7H,2-5H2,1H3,(H,9,10) |
| InChIKey | TYXLGIZCHHWATF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|