C12H20O6Si — CID 70182808
(1S,2R,3S)-3-(2-trimethylsilylethoxycarbonyl)cyclobutane-1,2-dicarboxylic acid (PubChem CID 70182808) has the molecular formula C12H20O6Si and a molecular weight of 288.37 g/mol. Its IUPAC name is (1S,2R,3S)-3-(2-trimethylsilylethoxycarbonyl)cyclobutane-1,2-dicarboxylic acid.
| Compound Name | (1S,2R,3S)-3-(2-trimethylsilylethoxycarbonyl)cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70182808 |
| Molecular Formula | C12H20O6Si |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (1S,2R,3S)-3-(2-trimethylsilylethoxycarbonyl)cyclobutane-1,2-dicarboxylic acid |
| SMILES | C[Si](C)(C)CCOC(=O)[C@H]1C[C@H](C(=O)O)[C@H]1C(=O)O |
| InChI | InChI=1S/C12H20O6Si/c1-19(2,3)5-4-18-12(17)8-6-7(10(13)14)9(8)11(15)16/h7-9H,4-6H2,1-3H3,(H,13,14)(H,15,16)/t7-,8-,9+/m0/s1 |
| InChIKey | QMRFMNSHWNKGCF-XHNCKOQMSA-N |
| XLogP | 1.29 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|