C12H23FO3Si — CID 59001147
2-trimethylsilylethyl 3-fluoro-4-hydroxycyclohexane-1-carboxylate (PubChem CID 59001147) has the molecular formula C12H23FO3Si and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-fluoro-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 3-fluoro-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59001147 |
| Molecular Formula | C12H23FO3Si |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-trimethylsilylethyl 3-fluoro-4-hydroxycyclohexane-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)C1CCC(O)C(F)C1 |
| InChI | InChI=1S/C12H23FO3Si/c1-17(2,3)7-6-16-12(15)9-4-5-11(14)10(13)8-9/h9-11,14H,4-8H2,1-3H3 |
| InChIKey | XQSSWWWCZMSCKE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|