C13H25NO4Si — CID 11087431
4-O-methyl 2-O-(2-trimethylsilylethyl) (2S,4R)-piperidine-2,4-dicarboxylate (PubChem CID 11087431) has the molecular formula C13H25NO4Si and a molecular weight of 287.43 g/mol. Its IUPAC name is 4-O-methyl 2-O-(2-trimethylsilylethyl) (2S,4R)-piperidine-2,4-dicarboxylate.
| Compound Name | 4-O-methyl 2-O-(2-trimethylsilylethyl) (2S,4R)-piperidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11087431 |
| Molecular Formula | C13H25NO4Si |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-O-methyl 2-O-(2-trimethylsilylethyl) (2S,4R)-piperidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CCN[C@H](C(=O)OCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C13H25NO4Si/c1-17-12(15)10-5-6-14-11(9-10)13(16)18-7-8-19(2,3)4/h10-11,14H,5-9H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | XZTKQWMENNMQIL-MNOVXSKESA-N |
| XLogP | 1.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|