About ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate
ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate (PubChem CID 91131520) has the molecular formula C21H40O4
and a molecular weight of 356.55 g/mol. Its IUPAC name is ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate |
| PubChem CID | 91131520 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate |
| SMILES | CC.CC.CC1CCCCC1C(=O)OCOC(=O)C1CCCCC1C |
| InChI | InChI=1S/C17H28O4.2C2H6/c1-12-7-3-5-9-14(12)16(18)20-11-21-17(19)15-10-6-4-8-13(15)2;2*1-2/h12-15H,3-11H2,1-2H3;2*1-2H3 |
| InChIKey | JWFMIHXUJZCVHG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate?
The IUPAC name of ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate (CID 91131520) is ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate.
What is the SMILES notation for ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate?
The canonical SMILES for ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate is CC.CC.CC1CCCCC1C(=O)OCOC(=O)C1CCCCC1C.
What is the InChIKey of ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate?
The InChIKey is JWFMIHXUJZCVHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O4.2C2H6/c1-12-7-3-5-9-14(12)16(18)20-11-21-17(19)15-10-6-4-8-13(15)2;2*1-2/h12-15H,3-11H2,1-2H3;2*1-2H3.
What are the key properties of ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate?
ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate has a molecular weight of 356.55 g/mol, XLogP of 5.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methylcyclohexanecarbonyl)oxymethyl 2-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 91131520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).