C10H11N2O+ — CID 159783647
N-[(1-but-3-ynylpyridin-1-ium-2-yl)methylidene]hydroxylamine (PubChem CID 159783647) has the molecular formula C10H11N2O+ and a molecular weight of 175.21 g/mol. Its IUPAC name is N-[(1-but-3-ynylpyridin-1-ium-2-yl)methylidene]hydroxylamine.
| Compound Name | N-[(1-but-3-ynylpyridin-1-ium-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 159783647 |
| Molecular Formula | C10H11N2O+ |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | N-[(1-but-3-ynylpyridin-1-ium-2-yl)methylidene]hydroxylamine |
| SMILES | C#CCC[n+]1ccccc1C=NO |
| InChI | InChI=1S/C10H10N2O/c1-2-3-7-12-8-5-4-6-10(12)9-11-13/h1,4-6,8-9H,3,7H2/p+1 |
| InChIKey | NHRGSVSRPYDUAU-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|