About cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine
cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine (PubChem CID 159784377) has the molecular formula C15H37N3
and a molecular weight of 259.48 g/mol. Its IUPAC name is cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine.
Molecular Properties
| Compound Name | cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine |
| PubChem CID | 159784377 |
| Molecular Formula | C15H37N3 |
| Molecular Weight | 259.48 g/mol |
| Exact Mass | 259.30 |
| IUPAC Name | cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine |
| SMILES | CC(C)CCN.CC(C)CN.NCC1CCCC1 |
| InChI | InChI=1S/C6H13N.C5H13N.C4H11N/c7-5-6-3-1-2-4-6;1-5(2)3-4-6;1-4(2)3-5/h6H,1-5,7H2;5H,3-4,6H2,1-2H3;4H,3,5H2,1-2H3 |
| InChIKey | NHTNWVSPGAEFNZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine?
The IUPAC name of cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine (CID 159784377) is cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine.
What is the SMILES notation for cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine?
The canonical SMILES for cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine is CC(C)CCN.CC(C)CN.NCC1CCCC1.
What is the InChIKey of cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine?
The InChIKey is NHTNWVSPGAEFNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H13N.C4H11N/c7-5-6-3-1-2-4-6;1-5(2)3-4-6;1-4(2)3-5/h6H,1-5,7H2;5H,3-4,6H2,1-2H3;4H,3,5H2,1-2H3.
What are the key properties of cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine?
cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine has a molecular weight of 259.48 g/mol, XLogP of 2.73, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethanamine;3-methylbutan-1-amine;2-methylpropan-1-amine is sourced from PubChem (CID 159784377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).