C20H21FN4O4S2 — CID 159785532
1-[2-(3-fluoro-4-methoxyanilino)acetyl]-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide;molecular hydrogen (PubChem CID 159785532) has the molecular formula C20H21FN4O4S2 and a molecular weight of 464.54 g/mol. Its IUPAC name is 1-[2-(3-fluoro-4-methoxyanilino)acetyl]-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide;molecular hydrogen.
| Compound Name | 1-[2-(3-fluoro-4-methoxyanilino)acetyl]-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 159785532 |
| Molecular Formula | C20H21FN4O4S2 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 1-[2-(3-fluoro-4-methoxyanilino)acetyl]-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide;molecular hydrogen |
| SMILES | COc1ccc(NCC(=O)N2CCc3cc(S(=O)(=O)Nc4nccs4)ccc32)cc1F.[H][H] |
| InChI | InChI=1S/C20H19FN4O4S2.H2/c1-29-18-5-2-14(11-16(18)21)23-12-19(26)25-8-6-13-10-15(3-4-17(13)25)31(27,28)24-20-22-7-9-30-20;/h2-5,7,9-11,23H,6,8,12H2,1H3,(H,22,24);1H |
| InChIKey | NHWZUZIPCCPHAQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|