C31H30N6O6S4 — CID 162085927
1-[2-(2-methoxyphenyl)acetyl]-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide;N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-indole-5-sulfonamide (PubChem CID 162085927) has the molecular formula C31H30N6O6S4 and a molecular weight of 710.89 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)acetyl]-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide;N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-indole-5-sulfonamide.
| Compound Name | 1-[2-(2-methoxyphenyl)acetyl]-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide;N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 162085927 |
| Molecular Formula | C31H30N6O6S4 |
| Molecular Weight | 710.89 g/mol |
| Exact Mass | 710.11 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)acetyl]-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide;N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-indole-5-sulfonamide |
| SMILES | COc1ccccc1CC(=O)N1CCc2cc(S(=O)(=O)Nc3nccs3)ccc21.O=S(=O)(Nc1nccs1)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C20H19N3O4S2.C11H11N3O2S2/c1-27-18-5-3-2-4-15(18)13-19(24)23-10-8-14-12-16(6-7-17(14)23)29(25,26)22-20-21-9-11-28-20;15-18(16,14-11-13-5-6-17-11)9-1-2-10-8(7-9)3-4-12-10/h2-7,9,11-12H,8,10,13H2,1H3,(H,21,22);1-2,5-7,12H,3-4H2,(H,13,14) |
| InChIKey | ZCYMMEUNDUTGIG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.89 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |