C16H13FN4O3 — CID 159785938
N-(diaminomethylidene)-2-(2-fluoro-5-methoxyphenyl)-6-hydroxy-3-isocyanobenzamide (PubChem CID 159785938) has the molecular formula C16H13FN4O3 and a molecular weight of 328.30 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(2-fluoro-5-methoxyphenyl)-6-hydroxy-3-isocyanobenzamide.
| Compound Name | N-(diaminomethylidene)-2-(2-fluoro-5-methoxyphenyl)-6-hydroxy-3-isocyanobenzamide |
|---|---|
| PubChem CID | 159785938 |
| Molecular Formula | C16H13FN4O3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-(diaminomethylidene)-2-(2-fluoro-5-methoxyphenyl)-6-hydroxy-3-isocyanobenzamide |
| SMILES | [C-]#[N+]c1ccc(O)c(C(=O)N=C(N)N)c1-c1cc(OC)ccc1F |
| InChI | InChI=1S/C16H13FN4O3/c1-20-11-5-6-12(22)14(15(23)21-16(18)19)13(11)9-7-8(24-2)3-4-10(9)17/h3-7,22H,2H3,(H4,18,19,21,23) |
| InChIKey | NHYHQMUKZBZXNI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|