C14H14N4O2 — CID 140877559
1-[1-(2-isocyano-5-methoxyphenyl)-1,2,4-triazol-3-yl]-2-methylpropan-1-one (PubChem CID 140877559) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 1-[1-(2-isocyano-5-methoxyphenyl)-1,2,4-triazol-3-yl]-2-methylpropan-1-one.
| Compound Name | 1-[1-(2-isocyano-5-methoxyphenyl)-1,2,4-triazol-3-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 140877559 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-[1-(2-isocyano-5-methoxyphenyl)-1,2,4-triazol-3-yl]-2-methylpropan-1-one |
| SMILES | [C-]#[N+]c1ccc(OC)cc1-n1cnc(C(=O)C(C)C)n1 |
| InChI | InChI=1S/C14H14N4O2/c1-9(2)13(19)14-16-8-18(17-14)12-7-10(20-4)5-6-11(12)15-3/h5-9H,1-2,4H3 |
| InChIKey | JYALXGDAABZQTL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|