C27H48O9S — CID 159786974
[(2S,3R,6R)-3-hydroxy-2-(hydroxymethyl)-6-[(3R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] hydrogen sulfate (PubChem CID 159786974) has the molecular formula C27H48O9S and a molecular weight of 548.74 g/mol. Its IUPAC name is [(2S,3R,6R)-3-hydroxy-2-(hydroxymethyl)-6-[(3R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] hydrogen sulfate.
| Compound Name | [(2S,3R,6R)-3-hydroxy-2-(hydroxymethyl)-6-[(3R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] hydrogen sulfate |
|---|---|
| PubChem CID | 159786974 |
| Molecular Formula | C27H48O9S |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | [(2S,3R,6R)-3-hydroxy-2-(hydroxymethyl)-6-[(3R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] hydrogen sulfate |
| SMILES | C[C@H](CC[C@@H](O)[C@@H](CO)COS(=O)(=O)O)C1CCC2C3C(O)CC4C[C@H](O)CCC4(C)C3CC(O)C21C |
| InChI | InChI=1S/C27H48O9S/c1-15(4-7-22(30)16(13-28)14-36-37(33,34)35)19-5-6-20-25-21(12-24(32)27(19,20)3)26(2)9-8-18(29)10-17(26)11-23(25)31/h15-25,28-32H,4-14H2,1-3H3,(H,33,34,35)/t15-,16+,17?,18-,19?,20?,21?,22-,23?,24?,25?,26?,27?/m1/s1 |
| InChIKey | JKUSPYUETNXNRO-QLIXZRRASA-N |
| XLogP | 2.15 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|