C14H24O2 — CID 159791134
3,3-dimethylpent-4-enal;1-ethenoxy-3-methylbut-2-ene (PubChem CID 159791134) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 3,3-dimethylpent-4-enal;1-ethenoxy-3-methylbut-2-ene.
| Compound Name | 3,3-dimethylpent-4-enal;1-ethenoxy-3-methylbut-2-ene |
|---|---|
| PubChem CID | 159791134 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3,3-dimethylpent-4-enal;1-ethenoxy-3-methylbut-2-ene |
| SMILES | C=CC(C)(C)CC=O.C=COCC=C(C)C |
| InChI | InChI=1S/2C7H12O/c1-4-8-6-5-7(2)3;1-4-7(2,3)5-6-8/h4-5H,1,6H2,2-3H3;4,6H,1,5H2,2-3H3 |
| InChIKey | NIONZBBIRQPEDN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|