About 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol
5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol (PubChem CID 159792761) has the molecular formula C15H19N3O4
and a molecular weight of 305.33 g/mol. Its IUPAC name is 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol.
Molecular Properties
| Compound Name | 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol |
| PubChem CID | 159792761 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol |
| SMILES | O=[N+]([O-])c1ccc([O-])c2ncccc12.OCC[NH+]1CCCC1 |
| InChI | InChI=1S/C9H6N2O3.C6H13NO/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8;8-6-5-7-3-1-2-4-7/h1-5,12H;8H,1-6H2 |
| InChIKey | NITVYMOADYSPKT-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol?
The IUPAC name of 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol (CID 159792761) is 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol.
What is the SMILES notation for 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol?
The canonical SMILES for 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol is O=[N+]([O-])c1ccc([O-])c2ncccc12.OCC[NH+]1CCCC1.
What is the InChIKey of 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol?
The InChIKey is NITVYMOADYSPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3.C6H13NO/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8;8-6-5-7-3-1-2-4-7/h1-5,12H;8H,1-6H2.
What are the key properties of 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol?
5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol has a molecular weight of 305.33 g/mol, XLogP of -0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitroquinolin-8-olate;2-pyrrolidin-1-ium-1-ylethanol is sourced from PubChem (CID 159792761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).