C42H36BBrN6O4 — CID 159794285
6-bromo-8-methoxy-N-phenylquinazolin-2-amine;8-methoxy-N,6-diphenylquinazolin-2-amine;phenylboronic acid (PubChem CID 159794285) has the molecular formula C42H36BBrN6O4 and a molecular weight of 779.50 g/mol. Its IUPAC name is 6-bromo-8-methoxy-N-phenylquinazolin-2-amine;8-methoxy-N,6-diphenylquinazolin-2-amine;phenylboronic acid.
| Compound Name | 6-bromo-8-methoxy-N-phenylquinazolin-2-amine;8-methoxy-N,6-diphenylquinazolin-2-amine;phenylboronic acid |
|---|---|
| PubChem CID | 159794285 |
| Molecular Formula | C42H36BBrN6O4 |
| Molecular Weight | 779.50 g/mol |
| Exact Mass | 778.21 |
| IUPAC Name | 6-bromo-8-methoxy-N-phenylquinazolin-2-amine;8-methoxy-N,6-diphenylquinazolin-2-amine;phenylboronic acid |
| SMILES | COc1cc(-c2ccccc2)cc2cnc(Nc3ccccc3)nc12.COc1cc(Br)cc2cnc(Nc3ccccc3)nc12.OB(O)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O.C15H12BrN3O.C6H7BO2/c1-25-19-13-16(15-8-4-2-5-9-15)12-17-14-22-21(24-20(17)19)23-18-10-6-3-7-11-18;1-20-13-8-11(16)7-10-9-17-15(19-14(10)13)18-12-5-3-2-4-6-12;8-7(9)6-4-2-1-3-5-6/h2-14H,1H3,(H,22,23,24);2-9H,1H3,(H,17,18,19);1-5,8-9H |
| InChIKey | NIYVLXDNVJIVRT-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.50 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|