C22H28Cl2O4 — CID 159796168
3-(4-chlorophenyl)propanoic acid;3-(4-chlorophenyl)propan-1-ol;oxolane (PubChem CID 159796168) has the molecular formula C22H28Cl2O4 and a molecular weight of 427.37 g/mol. Its IUPAC name is 3-(4-chlorophenyl)propanoic acid;3-(4-chlorophenyl)propan-1-ol;oxolane.
| Compound Name | 3-(4-chlorophenyl)propanoic acid;3-(4-chlorophenyl)propan-1-ol;oxolane |
|---|---|
| PubChem CID | 159796168 |
| Molecular Formula | C22H28Cl2O4 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-(4-chlorophenyl)propanoic acid;3-(4-chlorophenyl)propan-1-ol;oxolane |
| SMILES | C1CCOC1.O=C(O)CCc1ccc(Cl)cc1.OCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClO2.C9H11ClO.C4H8O/c10-8-4-1-7(2-5-8)3-6-9(11)12;10-9-5-3-8(4-6-9)2-1-7-11;1-2-4-5-3-1/h1-2,4-5H,3,6H2,(H,11,12);3-6,11H,1-2,7H2;1-4H2 |
| InChIKey | NJEXMNYMPJBBLJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |