C25H30N4O2 — CID 15979706
N-(3-methoxypropyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,8'-7,9-dihydro-6H-imidazo[4,5-h]quinoline]-5'-carboxamide (PubChem CID 15979706) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,8'-7,9-dihydro-6H-imidazo[4,5-h]quinoline]-5'-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,8'-7,9-dihydro-6H-imidazo[4,5-h]quinoline]-5'-carboxamide |
|---|---|
| PubChem CID | 15979706 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-(3-methoxypropyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,8'-7,9-dihydro-6H-imidazo[4,5-h]quinoline]-5'-carboxamide |
| SMILES | COCCCNC(=O)c1cc2c(nc(C)n2C)c2c1CCC1(Cc3ccccc3C1)N2 |
| InChI | InChI=1S/C25H30N4O2/c1-16-27-23-21(29(16)2)13-20(24(30)26-11-6-12-31-3)19-9-10-25(28-22(19)23)14-17-7-4-5-8-18(17)15-25/h4-5,7-8,13,28H,6,9-12,14-15H2,1-3H3,(H,26,30) |
| InChIKey | OVVLYHFPLMEQMT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|