C25H29N3O3 — CID 25000841
N-(2-ethoxyethyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,8'-6,7-dihydropyrano[2,3-e]benzimidazole]-5'-carboxamide (PubChem CID 25000841) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,8'-6,7-dihydropyrano[2,3-e]benzimidazole]-5'-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,8'-6,7-dihydropyrano[2,3-e]benzimidazole]-5'-carboxamide |
|---|---|
| PubChem CID | 25000841 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-(2-ethoxyethyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,8'-6,7-dihydropyrano[2,3-e]benzimidazole]-5'-carboxamide |
| SMILES | CCOCCNC(=O)c1cc2c(nc(C)n2C)c2c1CCC1(Cc3ccccc3C1)O2 |
| InChI | InChI=1S/C25H29N3O3/c1-4-30-12-11-26-24(29)20-13-21-22(27-16(2)28(21)3)23-19(20)9-10-25(31-23)14-17-7-5-6-8-18(17)15-25/h5-8,13H,4,9-12,14-15H2,1-3H3,(H,26,29) |
| InChIKey | VDHRYGVMMJCCMD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|