C22H26Cl2FN3O2 — CID 159797717
dichloromethane;2-[3-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidin-1-yl]ethanol (PubChem CID 159797717) has the molecular formula C22H26Cl2FN3O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is dichloromethane;2-[3-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidin-1-yl]ethanol.
| Compound Name | dichloromethane;2-[3-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 159797717 |
| Molecular Formula | C22H26Cl2FN3O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | dichloromethane;2-[3-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidin-1-yl]ethanol |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3CCCN(CCO)C3)cc12.ClCCl |
| InChI | InChI=1S/C21H24FN3O2.CH2Cl2/c1-27-20-5-4-15(22)11-17(20)16-6-7-23-21-18(16)12-19(24-21)14-3-2-8-25(13-14)9-10-26;2-1-3/h4-7,11-12,14,26H,2-3,8-10,13H2,1H3,(H,23,24);1H2 |
| InChIKey | NJJPTRPMNDLKHN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|