C31H33NO14 — CID 159799751
[2-oxo-2-[2-[2-[4-[(2-propanoyloxyacetyl)amino]benzoyl]oxyacetyl]oxyethoxy]ethyl] 4-(2-oxo-3-propanoyloxypropyl)benzoate (PubChem CID 159799751) has the molecular formula C31H33NO14 and a molecular weight of 643.60 g/mol. Its IUPAC name is [2-oxo-2-[2-[2-[4-[(2-propanoyloxyacetyl)amino]benzoyl]oxyacetyl]oxyethoxy]ethyl] 4-(2-oxo-3-propanoyloxypropyl)benzoate.
| Compound Name | [2-oxo-2-[2-[2-[4-[(2-propanoyloxyacetyl)amino]benzoyl]oxyacetyl]oxyethoxy]ethyl] 4-(2-oxo-3-propanoyloxypropyl)benzoate |
|---|---|
| PubChem CID | 159799751 |
| Molecular Formula | C31H33NO14 |
| Molecular Weight | 643.60 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | [2-oxo-2-[2-[2-[4-[(2-propanoyloxyacetyl)amino]benzoyl]oxyacetyl]oxyethoxy]ethyl] 4-(2-oxo-3-propanoyloxypropyl)benzoate |
| SMILES | CCC(=O)OCC(=O)Cc1ccc(C(=O)OCC(=O)OCCOC(=O)COC(=O)c2ccc(NC(=O)COC(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C31H33NO14/c1-3-26(35)43-16-24(33)15-20-5-7-21(8-6-20)30(39)45-18-28(37)41-13-14-42-29(38)19-46-31(40)22-9-11-23(12-10-22)32-25(34)17-44-27(36)4-2/h5-12H,3-4,13-19H2,1-2H3,(H,32,34) |
| InChIKey | SVFYOFQIAWYWQS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 203.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|