C21H19F3N4OS2 — CID 15980026
N'-methyl-4-methylsulfanyl-1-(4-methylsulfanylphenyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboximidamide (PubChem CID 15980026) has the molecular formula C21H19F3N4OS2 and a molecular weight of 464.54 g/mol. Its IUPAC name is N'-methyl-4-methylsulfanyl-1-(4-methylsulfanylphenyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboximidamide.
| Compound Name | N'-methyl-4-methylsulfanyl-1-(4-methylsulfanylphenyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 15980026 |
| Molecular Formula | C21H19F3N4OS2 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N'-methyl-4-methylsulfanyl-1-(4-methylsulfanylphenyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboximidamide |
| SMILES | C/N=C(\N)c1c(SC)nc(-c2ccc(C(F)(F)F)cc2)n(-c2ccc(SC)cc2)c1=O |
| InChI | InChI=1S/C21H19F3N4OS2/c1-26-17(25)16-19(31-3)27-18(12-4-6-13(7-5-12)21(22,23)24)28(20(16)29)14-8-10-15(30-2)11-9-14/h4-11H,1-3H3,(H2,25,26) |
| InChIKey | HYRBHPYKSCUITO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|