C19H14FN3OS2 — CID 59120430
2-(4-fluorophenyl)-5-isocyano-6-methylsulfanyl-3-(4-methylsulfanylphenyl)pyrimidin-4-one (PubChem CID 59120430) has the molecular formula C19H14FN3OS2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-isocyano-6-methylsulfanyl-3-(4-methylsulfanylphenyl)pyrimidin-4-one.
| Compound Name | 2-(4-fluorophenyl)-5-isocyano-6-methylsulfanyl-3-(4-methylsulfanylphenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 59120430 |
| Molecular Formula | C19H14FN3OS2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2-(4-fluorophenyl)-5-isocyano-6-methylsulfanyl-3-(4-methylsulfanylphenyl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1c(SC)nc(-c2ccc(F)cc2)n(-c2ccc(SC)cc2)c1=O |
| InChI | InChI=1S/C19H14FN3OS2/c1-21-16-18(26-3)22-17(12-4-6-13(20)7-5-12)23(19(16)24)14-8-10-15(25-2)11-9-14/h4-11H,2-3H3 |
| InChIKey | PPGIIFOOOVWGOH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|