About 1-aminopropyl 3-amino-2-oxopropanimidate
1-aminopropyl 3-amino-2-oxopropanimidate (PubChem CID 159802756) has the molecular formula C6H13N3O2
and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-aminopropyl 3-amino-2-oxopropanimidate.
Molecular Properties
| Compound Name | 1-aminopropyl 3-amino-2-oxopropanimidate |
| PubChem CID | 159802756 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1-aminopropyl 3-amino-2-oxopropanimidate |
| SMILES | [H]/N=C(\OC(N)CC)C(=O)CN |
| InChI | InChI=1S/C6H13N3O2/c1-2-5(8)11-6(9)4(10)3-7/h5,9H,2-3,7-8H2,1H3/b9-6- |
| InChIKey | NJZUCTUNSUHMNM-TWGQIWQCSA-N |
| XLogP | -0.80 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropyl 3-amino-2-oxopropanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropyl 3-amino-2-oxopropanimidate?
The IUPAC name of 1-aminopropyl 3-amino-2-oxopropanimidate (CID 159802756) is 1-aminopropyl 3-amino-2-oxopropanimidate.
What is the SMILES notation for 1-aminopropyl 3-amino-2-oxopropanimidate?
The canonical SMILES for 1-aminopropyl 3-amino-2-oxopropanimidate is [H]/N=C(\OC(N)CC)C(=O)CN.
What is the InChIKey of 1-aminopropyl 3-amino-2-oxopropanimidate?
The InChIKey is NJZUCTUNSUHMNM-TWGQIWQCSA-N. The full InChI is InChI=1S/C6H13N3O2/c1-2-5(8)11-6(9)4(10)3-7/h5,9H,2-3,7-8H2,1H3/b9-6-.
What are the key properties of 1-aminopropyl 3-amino-2-oxopropanimidate?
1-aminopropyl 3-amino-2-oxopropanimidate has a molecular weight of 159.19 g/mol, XLogP of -0.80, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropyl 3-amino-2-oxopropanimidate is sourced from PubChem (CID 159802756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).