C9H18O2S2 — CID 159803437
methanol;(7-methylidene-1,5-dithiocan-3-yl)methanol (PubChem CID 159803437) has the molecular formula C9H18O2S2 and a molecular weight of 222.37 g/mol. Its IUPAC name is methanol;(7-methylidene-1,5-dithiocan-3-yl)methanol.
| Compound Name | methanol;(7-methylidene-1,5-dithiocan-3-yl)methanol |
|---|---|
| PubChem CID | 159803437 |
| Molecular Formula | C9H18O2S2 |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | methanol;(7-methylidene-1,5-dithiocan-3-yl)methanol |
| SMILES | C=C1CSCC(CO)CSC1.CO |
| InChI | InChI=1S/C8H14OS2.CH4O/c1-7-3-10-5-8(2-9)6-11-4-7;1-2/h8-9H,1-6H2;2H,1H3 |
| InChIKey | NKBSUIHSFGZQLW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|