About (7-methylidene-1,5-dithiocan-3-yl)methanol
(7-methylidene-1,5-dithiocan-3-yl)methanol (PubChem CID 69122747) has the molecular formula C8H14OS2
and a molecular weight of 190.33 g/mol. Its IUPAC name is (7-methylidene-1,5-dithiocan-3-yl)methanol.
Molecular Properties
| Compound Name | (7-methylidene-1,5-dithiocan-3-yl)methanol |
| PubChem CID | 69122747 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (7-methylidene-1,5-dithiocan-3-yl)methanol |
| SMILES | C=C1CSCC(CO)CSC1 |
| InChI | InChI=1S/C8H14OS2/c1-7-3-10-5-8(2-9)6-11-4-7/h8-9H,1-6H2 |
| InChIKey | BAOUCGOMCKCPFU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7-methylidene-1,5-dithiocan-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methylidene-1,5-dithiocan-3-yl)methanol?
The IUPAC name of (7-methylidene-1,5-dithiocan-3-yl)methanol (CID 69122747) is (7-methylidene-1,5-dithiocan-3-yl)methanol.
What is the SMILES notation for (7-methylidene-1,5-dithiocan-3-yl)methanol?
The canonical SMILES for (7-methylidene-1,5-dithiocan-3-yl)methanol is C=C1CSCC(CO)CSC1.
What is the InChIKey of (7-methylidene-1,5-dithiocan-3-yl)methanol?
The InChIKey is BAOUCGOMCKCPFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14OS2/c1-7-3-10-5-8(2-9)6-11-4-7/h8-9H,1-6H2.
What are the key properties of (7-methylidene-1,5-dithiocan-3-yl)methanol?
(7-methylidene-1,5-dithiocan-3-yl)methanol has a molecular weight of 190.33 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methylidene-1,5-dithiocan-3-yl)methanol is sourced from PubChem (CID 69122747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).