C11H4F16O — CID 159804646
1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4-tetrafluorocyclobutene (PubChem CID 159804646) has the molecular formula C11H4F16O and a molecular weight of 456.12 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4-tetrafluorocyclobutene.
| Compound Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4-tetrafluorocyclobutene |
|---|---|
| PubChem CID | 159804646 |
| Molecular Formula | C11H4F16O |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4-tetrafluorocyclobutene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC1=CC(F)(F)C1(F)F |
| InChI | InChI=1S/C11H4F16O/c12-4(13)8(20,21)10(24,25)11(26,27)9(22,23)6(16,17)2-28-3-1-5(14,15)7(3,18)19/h1,4H,2H2 |
| InChIKey | NKFTZBBDRLFMQT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|