C18H6F28O2 — CID 162115036
1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4-tetrafluorocyclobutene (PubChem CID 162115036) has the molecular formula C18H6F28O2 and a molecular weight of 786.19 g/mol. Its IUPAC name is 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4-tetrafluorocyclobutene.
| Compound Name | 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4-tetrafluorocyclobutene |
|---|---|
| PubChem CID | 162115036 |
| Molecular Formula | C18H6F28O2 |
| Molecular Weight | 786.19 g/mol |
| Exact Mass | 785.99 |
| IUPAC Name | 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4-tetrafluorocyclobutene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC1=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H6F28O2/c19-5(20)11(31,32)15(39,40)17(43,44)13(35,36)7(23,24)1-47-3-4(10(29,30)9(3,27)28)48-2-8(25,26)14(37,38)18(45,46)16(41,42)12(33,34)6(21)22/h5-6H,1-2H2 |
| InChIKey | ZGQPUESWDYARDR-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.19 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|