C20H6F32O2 — CID 154171412
1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4,5,5,6,6-octafluorocyclohexene (PubChem CID 154171412) has the molecular formula C20H6F32O2 and a molecular weight of 886.20 g/mol. Its IUPAC name is 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4,5,5,6,6-octafluorocyclohexene.
| Compound Name | 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4,5,5,6,6-octafluorocyclohexene |
|---|---|
| PubChem CID | 154171412 |
| Molecular Formula | C20H6F32O2 |
| Molecular Weight | 886.20 g/mol |
| Exact Mass | 885.99 |
| IUPAC Name | 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4,5,5,6,6-octafluorocyclohexene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC1=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C20H6F32O2/c21-5(22)11(33,34)17(45,46)19(49,50)13(37,38)7(25,26)1-53-3-4(10(31,32)16(43,44)15(41,42)9(3,29)30)54-2-8(27,28)14(39,40)20(51,52)18(47,48)12(35,36)6(23)24/h5-6H,1-2H2 |
| InChIKey | RZQAGIIYRTUBGR-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.20 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|