C19H32F6O2 — CID 141403784
5,6-bis(2,2,2-trifluoroethoxy)pentadec-5-ene (PubChem CID 141403784) has the molecular formula C19H32F6O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 5,6-bis(2,2,2-trifluoroethoxy)pentadec-5-ene.
| Compound Name | 5,6-bis(2,2,2-trifluoroethoxy)pentadec-5-ene |
|---|---|
| PubChem CID | 141403784 |
| Molecular Formula | C19H32F6O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 5,6-bis(2,2,2-trifluoroethoxy)pentadec-5-ene |
| SMILES | CCCCCCCCCC(OCC(F)(F)F)=C(CCCC)OCC(F)(F)F |
| InChI | InChI=1S/C19H32F6O2/c1-3-5-7-8-9-10-11-13-17(27-15-19(23,24)25)16(12-6-4-2)26-14-18(20,21)22/h3-15H2,1-2H3 |
| InChIKey | VOHCIEQDEWELLD-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|