C14H17F11O — CID 134881341
2-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxyoctane (PubChem CID 134881341) has the molecular formula C14H17F11O and a molecular weight of 410.27 g/mol. Its IUPAC name is 2-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxyoctane.
| Compound Name | 2-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxyoctane |
|---|---|
| PubChem CID | 134881341 |
| Molecular Formula | C14H17F11O |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]oxyoctane |
| SMILES | CCCCCCC(C)OC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H17F11O/c1-3-4-5-6-7-8(2)26-10(11(15,16)14(23,24)25)9(12(17,18)19)13(20,21)22/h8H,3-7H2,1-2H3 |
| InChIKey | VZZQSJBUHDPGKD-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|