C9H5F11O — CID 167433160
1-ethoxy-3,3,4,4,5,5-hexafluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclopentene (PubChem CID 167433160) has the molecular formula C9H5F11O and a molecular weight of 338.12 g/mol. Its IUPAC name is 1-ethoxy-3,3,4,4,5,5-hexafluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclopentene.
| Compound Name | 1-ethoxy-3,3,4,4,5,5-hexafluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclopentene |
|---|---|
| PubChem CID | 167433160 |
| Molecular Formula | C9H5F11O |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1-ethoxy-3,3,4,4,5,5-hexafluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclopentene |
| SMILES | CCOC1=C(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H5F11O/c1-2-21-4-3(6(12,13)9(18,19)20)5(10,11)8(16,17)7(4,14)15/h2H2,1H3 |
| InChIKey | AEXHOUMUYIZLFM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|