C10H12F6O2 — CID 176591344
3,3,4,4,5,5-hexafluoro-1-(3-methoxypropoxy)-2-methylcyclopentene (PubChem CID 176591344) has the molecular formula C10H12F6O2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(3-methoxypropoxy)-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(3-methoxypropoxy)-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591344 |
| Molecular Formula | C10H12F6O2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(3-methoxypropoxy)-2-methylcyclopentene |
| SMILES | COCCCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H12F6O2/c1-6-7(18-5-3-4-17-2)9(13,14)10(15,16)8(6,11)12/h3-5H2,1-2H3 |
| InChIKey | PHSBYLUOSISRNV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|