C11H14F6O2 — CID 176591313
3,3,4,4,5,5-hexafluoro-1-(4-methoxybutoxy)-2-methylcyclopentene (PubChem CID 176591313) has the molecular formula C11H14F6O2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(4-methoxybutoxy)-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(4-methoxybutoxy)-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591313 |
| Molecular Formula | C11H14F6O2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(4-methoxybutoxy)-2-methylcyclopentene |
| SMILES | COCCCCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H14F6O2/c1-7-8(19-6-4-3-5-18-2)10(14,15)11(16,17)9(7,12)13/h3-6H2,1-2H3 |
| InChIKey | MPKAGFCMTLUGMV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|