C9H10F6O2 — CID 176591340
3,3,4,4,5,5-hexafluoro-1-(2-methoxyethoxy)-2-methylcyclopentene (PubChem CID 176591340) has the molecular formula C9H10F6O2 and a molecular weight of 264.16 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(2-methoxyethoxy)-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(2-methoxyethoxy)-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591340 |
| Molecular Formula | C9H10F6O2 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(2-methoxyethoxy)-2-methylcyclopentene |
| SMILES | COCCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H10F6O2/c1-5-6(17-4-3-16-2)8(12,13)9(14,15)7(5,10)11/h3-4H2,1-2H3 |
| InChIKey | NMXLQGVAXTYUFB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|