C11H14F6O3 — CID 176591346
3,3,4,4,5,5-hexafluoro-1-[2-(2-methoxyethoxy)ethoxy]-2-methylcyclopentene (PubChem CID 176591346) has the molecular formula C11H14F6O3 and a molecular weight of 308.22 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-[2-(2-methoxyethoxy)ethoxy]-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-[2-(2-methoxyethoxy)ethoxy]-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591346 |
| Molecular Formula | C11H14F6O3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-[2-(2-methoxyethoxy)ethoxy]-2-methylcyclopentene |
| SMILES | COCCOCCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H14F6O3/c1-7-8(20-6-5-19-4-3-18-2)10(14,15)11(16,17)9(7,12)13/h3-6H2,1-2H3 |
| InChIKey | VIFHBJWDENLYFT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|