C14H20F6O2 — CID 176591338
3,3,4,4,5,5-hexafluoro-1-(6-methoxy-4-methylhexoxy)-2-methylcyclopentene (PubChem CID 176591338) has the molecular formula C14H20F6O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(6-methoxy-4-methylhexoxy)-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(6-methoxy-4-methylhexoxy)-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591338 |
| Molecular Formula | C14H20F6O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(6-methoxy-4-methylhexoxy)-2-methylcyclopentene |
| SMILES | COCCC(C)CCCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H20F6O2/c1-9(6-8-21-3)5-4-7-22-11-10(2)12(15,16)14(19,20)13(11,17)18/h9H,4-8H2,1-3H3 |
| InChIKey | SGPVTTOGLKOPOR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|