C11H16F4O — CID 11791301
[(Z)-1-ethoxy-2,3,3,3-tetrafluoroprop-1-enyl]cyclohexane (PubChem CID 11791301) has the molecular formula C11H16F4O and a molecular weight of 240.24 g/mol. Its IUPAC name is [(Z)-1-ethoxy-2,3,3,3-tetrafluoroprop-1-enyl]cyclohexane.
| Compound Name | [(Z)-1-ethoxy-2,3,3,3-tetrafluoroprop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 11791301 |
| Molecular Formula | C11H16F4O |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | [(Z)-1-ethoxy-2,3,3,3-tetrafluoroprop-1-enyl]cyclohexane |
| SMILES | CCO/C(=C(\F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H16F4O/c1-2-16-9(10(12)11(13,14)15)8-6-4-3-5-7-8/h8H,2-7H2,1H3/b10-9- |
| InChIKey | SNDHOMYOJFISCK-KTKRTIGZSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|