C15H20F6O2 — CID 176591354
1-[(3,3,4,4,5,5-hexafluoro-2-methylcyclopenten-1-yl)oxymethyl]-4-(methoxymethyl)cyclohexane (PubChem CID 176591354) has the molecular formula C15H20F6O2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-[(3,3,4,4,5,5-hexafluoro-2-methylcyclopenten-1-yl)oxymethyl]-4-(methoxymethyl)cyclohexane.
| Compound Name | 1-[(3,3,4,4,5,5-hexafluoro-2-methylcyclopenten-1-yl)oxymethyl]-4-(methoxymethyl)cyclohexane |
|---|---|
| PubChem CID | 176591354 |
| Molecular Formula | C15H20F6O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[(3,3,4,4,5,5-hexafluoro-2-methylcyclopenten-1-yl)oxymethyl]-4-(methoxymethyl)cyclohexane |
| SMILES | COCC1CCC(COC2=C(C)C(F)(F)C(F)(F)C2(F)F)CC1 |
| InChI | InChI=1S/C15H20F6O2/c1-9-12(14(18,19)15(20,21)13(9,16)17)23-8-11-5-3-10(4-6-11)7-22-2/h10-11H,3-8H2,1-2H3 |
| InChIKey | YBIKPAVMOVMRCL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|