C24H28F12O4 — CID 176591318
1,4-bis[(3,3,4,4,5,5-hexafluoro-2-propoxycyclopenten-1-yl)oxymethyl]cyclohexane (PubChem CID 176591318) has the molecular formula C24H28F12O4 and a molecular weight of 608.46 g/mol. Its IUPAC name is 1,4-bis[(3,3,4,4,5,5-hexafluoro-2-propoxycyclopenten-1-yl)oxymethyl]cyclohexane.
| Compound Name | 1,4-bis[(3,3,4,4,5,5-hexafluoro-2-propoxycyclopenten-1-yl)oxymethyl]cyclohexane |
|---|---|
| PubChem CID | 176591318 |
| Molecular Formula | C24H28F12O4 |
| Molecular Weight | 608.46 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 1,4-bis[(3,3,4,4,5,5-hexafluoro-2-propoxycyclopenten-1-yl)oxymethyl]cyclohexane |
| SMILES | CCCOC1=C(OCC2CCC(COC3=C(OCCC)C(F)(F)C(F)(F)C3(F)F)CC2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H28F12O4/c1-3-9-37-15-17(21(29,30)23(33,34)19(15,25)26)39-11-13-5-7-14(8-6-13)12-40-18-16(38-10-4-2)20(27,28)24(35,36)22(18,31)32/h13-14H,3-12H2,1-2H3 |
| InChIKey | KJKSWCKZEVOKCN-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.46 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|