C21H26F6O — CID 144809505
2,3-difluoro-1-[(4-methylcyclohexyl)methoxy]-4-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)cyclohexa-1,3-diene (PubChem CID 144809505) has the molecular formula C21H26F6O and a molecular weight of 408.43 g/mol. Its IUPAC name is 2,3-difluoro-1-[(4-methylcyclohexyl)methoxy]-4-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)cyclohexa-1,3-diene.
| Compound Name | 2,3-difluoro-1-[(4-methylcyclohexyl)methoxy]-4-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144809505 |
| Molecular Formula | C21H26F6O |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2,3-difluoro-1-[(4-methylcyclohexyl)methoxy]-4-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)cyclohexa-1,3-diene |
| SMILES | C=C(C)C(F)(F)C(F)(F)C(=C)C1=C(F)C(F)=C(OCC2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C21H26F6O/c1-12(2)20(24,25)21(26,27)14(4)16-9-10-17(19(23)18(16)22)28-11-15-7-5-13(3)6-8-15/h13,15H,1,4-11H2,2-3H3 |
| InChIKey | OWXLNQRTHNRLIX-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|