C22H29F4OYb- — CID 20625677
1-[2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethyl]-3,5-difluorobenzene-4-ide;ytterbium (PubChem CID 20625677) has the molecular formula C22H29F4OYb- and a molecular weight of 558.51 g/mol. Its IUPAC name is 1-[2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethyl]-3,5-difluorobenzene-4-ide;ytterbium.
| Compound Name | 1-[2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethyl]-3,5-difluorobenzene-4-ide;ytterbium |
|---|---|
| PubChem CID | 20625677 |
| Molecular Formula | C22H29F4OYb- |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 1-[2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethyl]-3,5-difluorobenzene-4-ide;ytterbium |
| SMILES | CC1CCC(C(F)(F)OC2CCC(CCc3cc(F)[c-]c(F)c3)CC2)CC1.[Yb] |
| InChI | InChI=1S/C22H29F4O.Yb/c1-15-2-8-18(9-3-15)22(25,26)27-21-10-6-16(7-11-21)4-5-17-12-19(23)14-20(24)13-17;/h12-13,15-16,18,21H,2-11H2,1H3;/q-1; |
| InChIKey | JAZNQPGPMJVCDE-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|