C21H34F2O — CID 54524393
2,2-difluoro-3-methyl-6-[4-[2-(4-methylcyclohex-3-en-1-yl)ethyl]cyclohexyl]oxane (PubChem CID 54524393) has the molecular formula C21H34F2O and a molecular weight of 340.50 g/mol. Its IUPAC name is 2,2-difluoro-3-methyl-6-[4-[2-(4-methylcyclohex-3-en-1-yl)ethyl]cyclohexyl]oxane.
| Compound Name | 2,2-difluoro-3-methyl-6-[4-[2-(4-methylcyclohex-3-en-1-yl)ethyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 54524393 |
| Molecular Formula | C21H34F2O |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2,2-difluoro-3-methyl-6-[4-[2-(4-methylcyclohex-3-en-1-yl)ethyl]cyclohexyl]oxane |
| SMILES | CC1=CCC(CCC2CCC(C3CCC(C)C(F)(F)O3)CC2)CC1 |
| InChI | InChI=1S/C21H34F2O/c1-15-3-6-17(7-4-15)8-9-18-10-12-19(13-11-18)20-14-5-16(2)21(22,23)24-20/h3,16-20H,4-14H2,1-2H3 |
| InChIKey | YSCHEJDFETUVTL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|