C25H40F4O — CID 58665449
1-methyl-4-[3-[4-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]oxypropyl]cyclohexane (PubChem CID 58665449) has the molecular formula C25H40F4O and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-methyl-4-[3-[4-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]oxypropyl]cyclohexane.
| Compound Name | 1-methyl-4-[3-[4-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]oxypropyl]cyclohexane |
|---|---|
| PubChem CID | 58665449 |
| Molecular Formula | C25H40F4O |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 1-methyl-4-[3-[4-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]oxypropyl]cyclohexane |
| SMILES | CC1CCC(CCCOC2CCC(C3CCC(C=C(F)C(F)(F)F)CC3)CC2)CC1 |
| InChI | InChI=1S/C25H40F4O/c1-18-4-6-19(7-5-18)3-2-16-30-23-14-12-22(13-15-23)21-10-8-20(9-11-21)17-24(26)25(27,28)29/h17-23H,2-16H2,1H3 |
| InChIKey | BPRGACQZTNIHAA-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|