C22H30F3OYb- — CID 20625679
1-[2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethyl]-3-fluorobenzene-4-ide;ytterbium (PubChem CID 20625679) has the molecular formula C22H30F3OYb- and a molecular weight of 540.52 g/mol. Its IUPAC name is 1-[2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethyl]-3-fluorobenzene-4-ide;ytterbium.
| Compound Name | 1-[2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethyl]-3-fluorobenzene-4-ide;ytterbium |
|---|---|
| PubChem CID | 20625679 |
| Molecular Formula | C22H30F3OYb- |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 1-[2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]ethyl]-3-fluorobenzene-4-ide;ytterbium |
| SMILES | CC1CCC(C(F)(F)OC2CCC(CCc3cc[c-]c(F)c3)CC2)CC1.[Yb] |
| InChI | InChI=1S/C22H30F3O.Yb/c1-16-5-11-19(12-6-16)22(24,25)26-21-13-9-17(10-14-21)7-8-18-3-2-4-20(23)15-18;/h2-3,15-17,19,21H,5-14H2,1H3;/q-1; |
| InChIKey | XLRJJZUTGIRPOW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|