C31H52F2O — CID 20599693
2-[4-[4-(5,5-difluoropent-4-enyl)cyclohexyl]butyl]-5-[4-[(E)-pent-1-enyl]cyclohexyl]oxane (PubChem CID 20599693) has the molecular formula C31H52F2O and a molecular weight of 478.75 g/mol. Its IUPAC name is 2-[4-[4-(5,5-difluoropent-4-enyl)cyclohexyl]butyl]-5-[4-[(E)-pent-1-enyl]cyclohexyl]oxane.
| Compound Name | 2-[4-[4-(5,5-difluoropent-4-enyl)cyclohexyl]butyl]-5-[4-[(E)-pent-1-enyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 20599693 |
| Molecular Formula | C31H52F2O |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | 2-[4-[4-(5,5-difluoropent-4-enyl)cyclohexyl]butyl]-5-[4-[(E)-pent-1-enyl]cyclohexyl]oxane |
| SMILES | CCC/C=C/C1CCC(C2CCC(CCCCC3CCC(CCCC=C(F)F)CC3)OC2)CC1 |
| InChI | InChI=1S/C31H52F2O/c1-2-3-4-9-27-18-20-28(21-19-27)29-22-23-30(34-24-29)12-7-5-10-25-14-16-26(17-15-25)11-6-8-13-31(32)33/h4,9,13,25-30H,2-3,5-8,10-12,14-24H2,1H3/b9-4+ |
| InChIKey | IAGXHYSDRZDHLF-RUDMXATFSA-N |
| XLogP | 10.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|